C7H5BF3N3O2 — CID 58118915
[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]boronic acid (PubChem CID 58118915) has the molecular formula C7H5BF3N3O2 and a molecular weight of 230.94 g/mol. Its IUPAC name is [3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]boronic acid.
| Compound Name | [3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]boronic acid |
|---|---|
| PubChem CID | 58118915 |
| Molecular Formula | C7H5BF3N3O2 |
| Molecular Weight | 230.94 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | [3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]boronic acid |
| SMILES | OB(O)c1ccc2nnc(C(F)(F)F)n2c1 |
| InChI | InChI=1S/C7H5BF3N3O2/c9-7(10,11)6-13-12-5-2-1-4(8(15)16)3-14(5)6/h1-3,15-16H |
| InChIKey | GTQXSNVMLRGFCA-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.94 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|