C23H17F3N2O6S2 — CID 58119543
2-[2-[5-methoxy-6-[2-[4-(trifluoromethyl)phenyl]ethynyl]-3-pyridinyl]-2-oxoethyl]sulfonylbenzenesulfonamide (PubChem CID 58119543) has the molecular formula C23H17F3N2O6S2 and a molecular weight of 538.53 g/mol. Its IUPAC name is 2-[2-[5-methoxy-6-[2-[4-(trifluoromethyl)phenyl]ethynyl]-3-pyridinyl]-2-oxoethyl]sulfonylbenzenesulfonamide.
| Compound Name | 2-[2-[5-methoxy-6-[2-[4-(trifluoromethyl)phenyl]ethynyl]-3-pyridinyl]-2-oxoethyl]sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 58119543 |
| Molecular Formula | C23H17F3N2O6S2 |
| Molecular Weight | 538.53 g/mol |
| Exact Mass | 538.05 |
| IUPAC Name | 2-[2-[5-methoxy-6-[2-[4-(trifluoromethyl)phenyl]ethynyl]-3-pyridinyl]-2-oxoethyl]sulfonylbenzenesulfonamide |
| SMILES | COc1cc(C(=O)CS(=O)(=O)c2ccccc2S(N)(=O)=O)cnc1C#Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H17F3N2O6S2/c1-34-20-12-16(13-28-18(20)11-8-15-6-9-17(10-7-15)23(24,25)26)19(29)14-35(30,31)21-4-2-3-5-22(21)36(27,32)33/h2-7,9-10,12-13H,14H2,1H3,(H2,27,32,33) |
| InChIKey | XININLRLXZHTJA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|