C33H39F4NO2Si — CID 58119706
tert-butyl-[[(8S)-9-(4-fluorophenyl)-3,6,6-trimethyl-1-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydro-1H-furo[3,4-b]quinolin-8-yl]oxy]-dimethylsilane (PubChem CID 58119706) has the molecular formula C33H39F4NO2Si and a molecular weight of 585.76 g/mol. Its IUPAC name is tert-butyl-[[(8S)-9-(4-fluorophenyl)-3,6,6-trimethyl-1-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydro-1H-furo[3,4-b]quinolin-8-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(8S)-9-(4-fluorophenyl)-3,6,6-trimethyl-1-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydro-1H-furo[3,4-b]quinolin-8-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 58119706 |
| Molecular Formula | C33H39F4NO2Si |
| Molecular Weight | 585.76 g/mol |
| Exact Mass | 585.27 |
| IUPAC Name | tert-butyl-[[(8S)-9-(4-fluorophenyl)-3,6,6-trimethyl-1-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydro-1H-furo[3,4-b]quinolin-8-yl]oxy]-dimethylsilane |
| SMILES | CC1OC(c2ccc(C(F)(F)F)cc2)c2c1nc1c(c2-c2ccc(F)cc2)[C@@H](O[Si](C)(C)C(C)(C)C)CC(C)(C)C1 |
| InChI | InChI=1S/C33H39F4NO2Si/c1-19-29-28(30(39-19)21-9-13-22(14-10-21)33(35,36)37)26(20-11-15-23(34)16-12-20)27-24(38-29)17-32(5,6)18-25(27)40-41(7,8)31(2,3)4/h9-16,19,25,30H,17-18H2,1-8H3/t19?,25-,30?/m0/s1 |
| InChIKey | CDXAAMMZTQWSMM-GGZUXXQESA-N |
| XLogP | 10.12 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.76 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|