C32H44F3NO2Si — CID 58119708
tert-butyl-[[(8S)-9-cyclopentyl-3,6,6-trimethyl-1-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydro-1H-furo[3,4-b]quinolin-8-yl]oxy]-dimethylsilane (PubChem CID 58119708) has the molecular formula C32H44F3NO2Si and a molecular weight of 559.79 g/mol. Its IUPAC name is tert-butyl-[[(8S)-9-cyclopentyl-3,6,6-trimethyl-1-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydro-1H-furo[3,4-b]quinolin-8-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(8S)-9-cyclopentyl-3,6,6-trimethyl-1-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydro-1H-furo[3,4-b]quinolin-8-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 58119708 |
| Molecular Formula | C32H44F3NO2Si |
| Molecular Weight | 559.79 g/mol |
| Exact Mass | 559.31 |
| IUPAC Name | tert-butyl-[[(8S)-9-cyclopentyl-3,6,6-trimethyl-1-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydro-1H-furo[3,4-b]quinolin-8-yl]oxy]-dimethylsilane |
| SMILES | CC1OC(c2ccc(C(F)(F)F)cc2)c2c1nc1c(c2C2CCCC2)[C@@H](O[Si](C)(C)C(C)(C)C)CC(C)(C)C1 |
| InChI | InChI=1S/C32H44F3NO2Si/c1-19-28-27(29(37-19)21-13-15-22(16-14-21)32(33,34)35)25(20-11-9-10-12-20)26-23(36-28)17-31(5,6)18-24(26)38-39(7,8)30(2,3)4/h13-16,19-20,24,29H,9-12,17-18H2,1-8H3/t19?,24-,29?/m0/s1 |
| InChIKey | WCFMXIGAPAETOS-QQXYLRSHSA-N |
| XLogP | 9.97 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.79 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|