C31H42F3NO2Si — CID 58119711
tert-butyl-[[(8S)-9-cyclopentyl-6,6-dimethyl-1-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydro-1H-furo[3,4-b]quinolin-8-yl]oxy]-dimethylsilane (PubChem CID 58119711) has the molecular formula C31H42F3NO2Si and a molecular weight of 545.76 g/mol. Its IUPAC name is tert-butyl-[[(8S)-9-cyclopentyl-6,6-dimethyl-1-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydro-1H-furo[3,4-b]quinolin-8-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(8S)-9-cyclopentyl-6,6-dimethyl-1-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydro-1H-furo[3,4-b]quinolin-8-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 58119711 |
| Molecular Formula | C31H42F3NO2Si |
| Molecular Weight | 545.76 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | tert-butyl-[[(8S)-9-cyclopentyl-6,6-dimethyl-1-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydro-1H-furo[3,4-b]quinolin-8-yl]oxy]-dimethylsilane |
| SMILES | CC1(C)Cc2nc3c(c(C4CCCC4)c2[C@@H](O[Si](C)(C)C(C)(C)C)C1)C(c1ccc(C(F)(F)F)cc1)OC3 |
| InChI | InChI=1S/C31H42F3NO2Si/c1-29(2,3)38(6,7)37-24-17-30(4,5)16-22-26(24)25(19-10-8-9-11-19)27-23(35-22)18-36-28(27)20-12-14-21(15-13-20)31(32,33)34/h12-15,19,24,28H,8-11,16-18H2,1-7H3/t24-,28?/m0/s1 |
| InChIKey | VILNJMYSLNVQOX-ZZDYIDRTSA-N |
| XLogP | 9.41 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.76 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|