C36H50F3NO2Si — CID 58119722
tert-butyl-[(8S)-9-cyclopentyl-6,6-dimethyl-1-[4-(trifluoromethyl)phenyl]spiro[1,5,7,8-tetrahydrofuro[3,4-b]quinoline-3,1'-cyclohexane]-8-yl]oxy-dimethylsilane (PubChem CID 58119722) has the molecular formula C36H50F3NO2Si and a molecular weight of 613.88 g/mol. Its IUPAC name is tert-butyl-[(8S)-9-cyclopentyl-6,6-dimethyl-1-[4-(trifluoromethyl)phenyl]spiro[1,5,7,8-tetrahydrofuro[3,4-b]quinoline-3,1'-cyclohexane]-8-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(8S)-9-cyclopentyl-6,6-dimethyl-1-[4-(trifluoromethyl)phenyl]spiro[1,5,7,8-tetrahydrofuro[3,4-b]quinoline-3,1'-cyclohexane]-8-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 58119722 |
| Molecular Formula | C36H50F3NO2Si |
| Molecular Weight | 613.88 g/mol |
| Exact Mass | 613.36 |
| IUPAC Name | tert-butyl-[(8S)-9-cyclopentyl-6,6-dimethyl-1-[4-(trifluoromethyl)phenyl]spiro[1,5,7,8-tetrahydrofuro[3,4-b]quinoline-3,1'-cyclohexane]-8-yl]oxy-dimethylsilane |
| SMILES | CC1(C)Cc2nc3c(c(C4CCCC4)c2[C@@H](O[Si](C)(C)C(C)(C)C)C1)C(c1ccc(C(F)(F)F)cc1)OC31CCCCC1 |
| InChI | InChI=1S/C36H50F3NO2Si/c1-33(2,3)43(6,7)42-27-22-34(4,5)21-26-29(27)28(23-13-9-10-14-23)30-31(24-15-17-25(18-16-24)36(37,38)39)41-35(32(30)40-26)19-11-8-12-20-35/h15-18,23,27,31H,8-14,19-22H2,1-7H3/t27-,31?/m0/s1 |
| InChIKey | SFOPMMIFTHKRRO-LMUZMDBKSA-N |
| XLogP | 11.07 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.88 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|