C33H46F3NO2Si — CID 58119729
tert-butyl-[[(8S)-9-cyclohexyl-3,6,6-trimethyl-1-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydro-1H-furo[3,4-b]quinolin-8-yl]oxy]-dimethylsilane (PubChem CID 58119729) has the molecular formula C33H46F3NO2Si and a molecular weight of 573.82 g/mol. Its IUPAC name is tert-butyl-[[(8S)-9-cyclohexyl-3,6,6-trimethyl-1-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydro-1H-furo[3,4-b]quinolin-8-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(8S)-9-cyclohexyl-3,6,6-trimethyl-1-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydro-1H-furo[3,4-b]quinolin-8-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 58119729 |
| Molecular Formula | C33H46F3NO2Si |
| Molecular Weight | 573.82 g/mol |
| Exact Mass | 573.32 |
| IUPAC Name | tert-butyl-[[(8S)-9-cyclohexyl-3,6,6-trimethyl-1-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydro-1H-furo[3,4-b]quinolin-8-yl]oxy]-dimethylsilane |
| SMILES | CC1OC(c2ccc(C(F)(F)F)cc2)c2c1nc1c(c2C2CCCCC2)[C@@H](O[Si](C)(C)C(C)(C)C)CC(C)(C)C1 |
| InChI | InChI=1S/C33H46F3NO2Si/c1-20-29-28(30(38-20)22-14-16-23(17-15-22)33(34,35)36)26(21-12-10-9-11-13-21)27-24(37-29)18-32(5,6)19-25(27)39-40(7,8)31(2,3)4/h14-17,20-21,25,30H,9-13,18-19H2,1-8H3/t20?,25-,30?/m0/s1 |
| InChIKey | IDWIEBYLDNOQKH-URTLEEMISA-N |
| XLogP | 10.36 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.82 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|