C32H44F3NO3Si — CID 58119782
tert-butyl-dimethyl-[[(8S)-3,6,6-trimethyl-9-(oxan-4-yl)-1-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydro-1H-furo[3,4-b]quinolin-8-yl]oxy]silane (PubChem CID 58119782) has the molecular formula C32H44F3NO3Si and a molecular weight of 575.79 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(8S)-3,6,6-trimethyl-9-(oxan-4-yl)-1-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydro-1H-furo[3,4-b]quinolin-8-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(8S)-3,6,6-trimethyl-9-(oxan-4-yl)-1-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydro-1H-furo[3,4-b]quinolin-8-yl]oxy]silane |
|---|---|
| PubChem CID | 58119782 |
| Molecular Formula | C32H44F3NO3Si |
| Molecular Weight | 575.79 g/mol |
| Exact Mass | 575.30 |
| IUPAC Name | tert-butyl-dimethyl-[[(8S)-3,6,6-trimethyl-9-(oxan-4-yl)-1-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydro-1H-furo[3,4-b]quinolin-8-yl]oxy]silane |
| SMILES | CC1OC(c2ccc(C(F)(F)F)cc2)c2c1nc1c(c2C2CCOCC2)[C@@H](O[Si](C)(C)C(C)(C)C)CC(C)(C)C1 |
| InChI | InChI=1S/C32H44F3NO3Si/c1-19-28-27(29(38-19)21-9-11-22(12-10-21)32(33,34)35)25(20-13-15-37-16-14-20)26-23(36-28)17-31(5,6)18-24(26)39-40(7,8)30(2,3)4/h9-12,19-20,24,29H,13-18H2,1-8H3/t19?,24-,29?/m0/s1 |
| InChIKey | DDYXCXZQIXQFLT-QQXYLRSHSA-N |
| XLogP | 9.21 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.79 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|