C19H26KN3O3S — CID 58119878
potassium 3-[3-(2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidin-1-yl)propyl-deuteriocarbamoyl]-2-oxo-1-(1,1,1,2-tetradeuteriopropan-2-yl)thieno[3,4-b]pyridin-4-olate (PubChem CID 58119878) has the molecular formula C19H26KN3O3S and a molecular weight of 430.69 g/mol. Its IUPAC name is potassium 3-[3-(2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidin-1-yl)propyl-deuteriocarbamoyl]-2-oxo-1-(1,1,1,2-tetradeuteriopropan-2-yl)thieno[3,4-b]pyridin-4-olate.
| Compound Name | potassium 3-[3-(2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidin-1-yl)propyl-deuteriocarbamoyl]-2-oxo-1-(1,1,1,2-tetradeuteriopropan-2-yl)thieno[3,4-b]pyridin-4-olate |
|---|---|
| PubChem CID | 58119878 |
| Molecular Formula | C19H26KN3O3S |
| Molecular Weight | 430.69 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | potassium 3-[3-(2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidin-1-yl)propyl-deuteriocarbamoyl]-2-oxo-1-(1,1,1,2-tetradeuteriopropan-2-yl)thieno[3,4-b]pyridin-4-olate |
| SMILES | [2H]N(CCCN1C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H])C(=O)c1c([O-])c2cscc2n(C([2H])(C)C([2H])([2H])[2H])c1=O.[K+] |
| InChI | InChI=1S/C19H27N3O3S.K/c1-13(2)22-15-12-26-11-14(15)17(23)16(19(22)25)18(24)20-7-6-10-21-8-4-3-5-9-21;/h11-13,23H,3-10H2,1-2H3,(H,20,24);/q;+1/p-1/i1D3,3D2,4D2,5D2,8D2,9D2,13D;/hD |
| InChIKey | VYYQFUJMLAAXAE-UYBRDROFSA-M |
| XLogP | -0.67 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.69 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |