C19H31N5O3S — CID 58119985
methyl 2-[(2R,4R)-4-[[(2S,3S)-2-azido-3-methylpentanoyl]-methylamino]-5-methylhexan-2-yl]-1,3-thiazole-4-carboxylate (PubChem CID 58119985) has the molecular formula C19H31N5O3S and a molecular weight of 409.56 g/mol. Its IUPAC name is methyl 2-[(2R,4R)-4-[[(2S,3S)-2-azido-3-methylpentanoyl]-methylamino]-5-methylhexan-2-yl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[(2R,4R)-4-[[(2S,3S)-2-azido-3-methylpentanoyl]-methylamino]-5-methylhexan-2-yl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 58119985 |
| Molecular Formula | C19H31N5O3S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | methyl 2-[(2R,4R)-4-[[(2S,3S)-2-azido-3-methylpentanoyl]-methylamino]-5-methylhexan-2-yl]-1,3-thiazole-4-carboxylate |
| SMILES | CC[C@H](C)[C@H](N=[N+]=[N-])C(=O)N(C)[C@H](C[C@@H](C)c1nc(C(=O)OC)cs1)C(C)C |
| InChI | InChI=1S/C19H31N5O3S/c1-8-12(4)16(22-23-20)18(25)24(6)15(11(2)3)9-13(5)17-21-14(10-28-17)19(26)27-7/h10-13,15-16H,8-9H2,1-7H3/t12-,13+,15+,16-/m0/s1 |
| InChIKey | PRJZIJZMGPGQPN-XNISGKROSA-N |
| XLogP | 4.63 |
| TPSA | 108.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|