C24H29FNO4P3S — CID 58120307
2-[(1R)-6-fluoro-8-(sulfinomethyl)-9-[(1S)-1-[4-[tris(phosphanyl)methyl]phenyl]ethyl]-1,2,3,4-tetrahydrocarbazol-1-yl]acetic acid (PubChem CID 58120307) has the molecular formula C24H29FNO4P3S and a molecular weight of 539.49 g/mol. Its IUPAC name is 2-[(1R)-6-fluoro-8-(sulfinomethyl)-9-[(1S)-1-[4-[tris(phosphanyl)methyl]phenyl]ethyl]-1,2,3,4-tetrahydrocarbazol-1-yl]acetic acid.
| Compound Name | 2-[(1R)-6-fluoro-8-(sulfinomethyl)-9-[(1S)-1-[4-[tris(phosphanyl)methyl]phenyl]ethyl]-1,2,3,4-tetrahydrocarbazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 58120307 |
| Molecular Formula | C24H29FNO4P3S |
| Molecular Weight | 539.49 g/mol |
| Exact Mass | 539.10 |
| IUPAC Name | 2-[(1R)-6-fluoro-8-(sulfinomethyl)-9-[(1S)-1-[4-[tris(phosphanyl)methyl]phenyl]ethyl]-1,2,3,4-tetrahydrocarbazol-1-yl]acetic acid |
| SMILES | C[C@@H](c1ccc(C(P)(P)P)cc1)n1c2c(c3cc(F)cc(CS(=O)O)c31)CCC[C@@H]2CC(=O)O |
| InChI | InChI=1S/C24H29FNO4P3S/c1-13(14-5-7-17(8-6-14)24(31,32)33)26-22-15(10-21(27)28)3-2-4-19(22)20-11-18(25)9-16(23(20)26)12-34(29)30/h5-9,11,13,15H,2-4,10,12,31-33H2,1H3,(H,27,28)(H,29,30)/t13-,15+/m0/s1 |
| InChIKey | UVXMCKYUDMXQLL-DZGCQCFKSA-N |
| XLogP | 5.74 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|