C25H31N5O9 — CID 58120725
2,6-diacetamido-N-[1,7-bis(2,5-dioxopyrrol-1-yl)-2,6-dioxoheptan-4-yl]hexanamide (PubChem CID 58120725) has the molecular formula C25H31N5O9 and a molecular weight of 545.55 g/mol. Its IUPAC name is 2,6-diacetamido-N-[1,7-bis(2,5-dioxopyrrol-1-yl)-2,6-dioxoheptan-4-yl]hexanamide.
| Compound Name | 2,6-diacetamido-N-[1,7-bis(2,5-dioxopyrrol-1-yl)-2,6-dioxoheptan-4-yl]hexanamide |
|---|---|
| PubChem CID | 58120725 |
| Molecular Formula | C25H31N5O9 |
| Molecular Weight | 545.55 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | 2,6-diacetamido-N-[1,7-bis(2,5-dioxopyrrol-1-yl)-2,6-dioxoheptan-4-yl]hexanamide |
| SMILES | CC(=O)NCCCCC(NC(C)=O)C(=O)NC(CC(=O)CN1C(=O)C=CC1=O)CC(=O)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C25H31N5O9/c1-15(31)26-10-4-3-5-20(27-16(2)32)25(39)28-17(11-18(33)13-29-21(35)6-7-22(29)36)12-19(34)14-30-23(37)8-9-24(30)38/h6-9,17,20H,3-5,10-14H2,1-2H3,(H,26,31)(H,27,32)(H,28,39) |
| InChIKey | RULITOXMLXVRDE-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 196.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.55 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|