C18H26FN3O6 — CID 58121029
[(2R,3R,4R,5R)-2-[5-fluoro-2-oxo-4-(pentoxycarbonylamino)pyrimidin-1-yl]-4,5-dimethyloxolan-3-yl] acetate (PubChem CID 58121029) has the molecular formula C18H26FN3O6 and a molecular weight of 399.42 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-[5-fluoro-2-oxo-4-(pentoxycarbonylamino)pyrimidin-1-yl]-4,5-dimethyloxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5R)-2-[5-fluoro-2-oxo-4-(pentoxycarbonylamino)pyrimidin-1-yl]-4,5-dimethyloxolan-3-yl] acetate |
|---|---|
| PubChem CID | 58121029 |
| Molecular Formula | C18H26FN3O6 |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | [(2R,3R,4R,5R)-2-[5-fluoro-2-oxo-4-(pentoxycarbonylamino)pyrimidin-1-yl]-4,5-dimethyloxolan-3-yl] acetate |
| SMILES | CCCCCOC(=O)Nc1nc(=O)n([C@@H]2O[C@H](C)[C@@H](C)[C@H]2OC(C)=O)cc1F |
| InChI | InChI=1S/C18H26FN3O6/c1-5-6-7-8-26-18(25)21-15-13(19)9-22(17(24)20-15)16-14(28-12(4)23)10(2)11(3)27-16/h9-11,14,16H,5-8H2,1-4H3,(H,20,21,24,25)/t10-,11-,14-,16-/m1/s1 |
| InChIKey | JUNFCVYUKSFKEH-MMYVAXCBSA-N |
| XLogP | 2.61 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|