C19H17N3O2S — CID 58121041
2-(3,4-dihydro-2H-quinolin-1-yl)-N-hydroxy-4-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 58121041) has the molecular formula C19H17N3O2S and a molecular weight of 351.43 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-quinolin-1-yl)-N-hydroxy-4-phenyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-N-hydroxy-4-phenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 58121041 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-N-hydroxy-4-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NO)c1sc(N2CCCc3ccccc32)nc1-c1ccccc1 |
| InChI | InChI=1S/C19H17N3O2S/c23-18(21-24)17-16(14-8-2-1-3-9-14)20-19(25-17)22-12-6-10-13-7-4-5-11-15(13)22/h1-5,7-9,11,24H,6,10,12H2,(H,21,23) |
| InChIKey | VXQJPBGDOQEBPB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|