C19H15NO2 — CID 58121123
N-hydroxy-2,5-diphenylbenzamide (PubChem CID 58121123) has the molecular formula C19H15NO2 and a molecular weight of 289.33 g/mol. Its IUPAC name is N-hydroxy-2,5-diphenylbenzamide.
| Compound Name | N-hydroxy-2,5-diphenylbenzamide |
|---|---|
| PubChem CID | 58121123 |
| Molecular Formula | C19H15NO2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | N-hydroxy-2,5-diphenylbenzamide |
| SMILES | O=C(NO)c1cc(-c2ccccc2)ccc1-c1ccccc1 |
| InChI | InChI=1S/C19H15NO2/c21-19(20-22)18-13-16(14-7-3-1-4-8-14)11-12-17(18)15-9-5-2-6-10-15/h1-13,22H,(H,20,21) |
| InChIKey | BZZBDRISFZMEMH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|