About N-hydroxy-2,5-diphenylbenzamide
N-hydroxy-2,5-diphenylbenzamide (PubChem CID 58121123) has the molecular formula C19H15NO2
and a molecular weight of 289.33 g/mol. Its IUPAC name is N-hydroxy-2,5-diphenylbenzamide.
Molecular Properties
| Compound Name | N-hydroxy-2,5-diphenylbenzamide |
| PubChem CID | 58121123 |
| Molecular Formula | C19H15NO2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | N-hydroxy-2,5-diphenylbenzamide |
| SMILES | O=C(NO)c1cc(-c2ccccc2)ccc1-c1ccccc1 |
| InChI | InChI=1S/C19H15NO2/c21-19(20-22)18-13-16(14-7-3-1-4-8-14)11-12-17(18)15-9-5-2-6-10-15/h1-13,22H,(H,20,21) |
| InChIKey | BZZBDRISFZMEMH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-2,5-diphenylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-2,5-diphenylbenzamide?
The IUPAC name of N-hydroxy-2,5-diphenylbenzamide (CID 58121123) is N-hydroxy-2,5-diphenylbenzamide.
What is the SMILES notation for N-hydroxy-2,5-diphenylbenzamide?
The canonical SMILES for N-hydroxy-2,5-diphenylbenzamide is O=C(NO)c1cc(-c2ccccc2)ccc1-c1ccccc1.
What is the InChIKey of N-hydroxy-2,5-diphenylbenzamide?
The InChIKey is BZZBDRISFZMEMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15NO2/c21-19(20-22)18-13-16(14-7-3-1-4-8-14)11-12-17(18)15-9-5-2-6-10-15/h1-13,22H,(H,20,21).
What are the key properties of N-hydroxy-2,5-diphenylbenzamide?
N-hydroxy-2,5-diphenylbenzamide has a molecular weight of 289.33 g/mol, XLogP of 4.14, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-2,5-diphenylbenzamide is sourced from PubChem (CID 58121123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).