C15H16ClF3N2O5S — CID 58121210
2-(3-chloro-6-methyl-5-nitro-1H-indol-2-yl)-1-(2,2,2-trifluoroethylsulfonyl)butan-2-ol (PubChem CID 58121210) has the molecular formula C15H16ClF3N2O5S and a molecular weight of 428.82 g/mol. Its IUPAC name is 2-(3-chloro-6-methyl-5-nitro-1H-indol-2-yl)-1-(2,2,2-trifluoroethylsulfonyl)butan-2-ol.
| Compound Name | 2-(3-chloro-6-methyl-5-nitro-1H-indol-2-yl)-1-(2,2,2-trifluoroethylsulfonyl)butan-2-ol |
|---|---|
| PubChem CID | 58121210 |
| Molecular Formula | C15H16ClF3N2O5S |
| Molecular Weight | 428.82 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | 2-(3-chloro-6-methyl-5-nitro-1H-indol-2-yl)-1-(2,2,2-trifluoroethylsulfonyl)butan-2-ol |
| SMILES | CCC(O)(CS(=O)(=O)CC(F)(F)F)c1[nH]c2cc(C)c([N+](=O)[O-])cc2c1Cl |
| InChI | InChI=1S/C15H16ClF3N2O5S/c1-3-14(22,6-27(25,26)7-15(17,18)19)13-12(16)9-5-11(21(23)24)8(2)4-10(9)20-13/h4-5,20,22H,3,6-7H2,1-2H3 |
| InChIKey | MNGYOSSYHCRYJD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.82 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|