C32H30ClN11O6 — CID 58121377
3-[[4-[[4-chloro-6-(methylcarbamoylamino)-1,3,5-triazin-2-yl]carbamoylamino]phenyl]methylcarbamoylamino]propyl N-(7-cyanato-9H-fluoren-2-yl)carbamate (PubChem CID 58121377) has the molecular formula C32H30ClN11O6 and a molecular weight of 700.12 g/mol. Its IUPAC name is 3-[[4-[[4-chloro-6-(methylcarbamoylamino)-1,3,5-triazin-2-yl]carbamoylamino]phenyl]methylcarbamoylamino]propyl N-(7-cyanato-9H-fluoren-2-yl)carbamate.
| Compound Name | 3-[[4-[[4-chloro-6-(methylcarbamoylamino)-1,3,5-triazin-2-yl]carbamoylamino]phenyl]methylcarbamoylamino]propyl N-(7-cyanato-9H-fluoren-2-yl)carbamate |
|---|---|
| PubChem CID | 58121377 |
| Molecular Formula | C32H30ClN11O6 |
| Molecular Weight | 700.12 g/mol |
| Exact Mass | 699.21 |
| IUPAC Name | 3-[[4-[[4-chloro-6-(methylcarbamoylamino)-1,3,5-triazin-2-yl]carbamoylamino]phenyl]methylcarbamoylamino]propyl N-(7-cyanato-9H-fluoren-2-yl)carbamate |
| SMILES | CNC(=O)Nc1nc(Cl)nc(NC(=O)Nc2ccc(CNC(=O)NCCCOC(=O)Nc3ccc4c(c3)Cc3cc(OC#N)ccc3-4)cc2)n1 |
| InChI | InChI=1S/C32H30ClN11O6/c1-35-29(45)43-27-40-26(33)41-28(42-27)44-31(47)38-21-5-3-18(4-6-21)16-37-30(46)36-11-2-12-49-32(48)39-22-7-9-24-19(14-22)13-20-15-23(50-17-34)8-10-25(20)24/h3-10,14-15H,2,11-13,16H2,1H3,(H,39,48)(H2,36,37,46)(H4,35,38,40,41,42,43,44,45,47) |
| InChIKey | PFWVJKWLDACDOM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 233.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.12 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|