C34H22ClN9O4 — CID 58121407
[7-[[4-chloro-6-[(7-isocyanato-9H-fluoren-2-yl)carbamoylamino]-1,3,5-triazin-2-yl]carbamoylamino]-9,10-dihydroanthracen-2-yl] cyanate (PubChem CID 58121407) has the molecular formula C34H22ClN9O4 and a molecular weight of 656.06 g/mol. Its IUPAC name is [7-[[4-chloro-6-[(7-isocyanato-9H-fluoren-2-yl)carbamoylamino]-1,3,5-triazin-2-yl]carbamoylamino]-9,10-dihydroanthracen-2-yl] cyanate.
| Compound Name | [7-[[4-chloro-6-[(7-isocyanato-9H-fluoren-2-yl)carbamoylamino]-1,3,5-triazin-2-yl]carbamoylamino]-9,10-dihydroanthracen-2-yl] cyanate |
|---|---|
| PubChem CID | 58121407 |
| Molecular Formula | C34H22ClN9O4 |
| Molecular Weight | 656.06 g/mol |
| Exact Mass | 655.15 |
| IUPAC Name | [7-[[4-chloro-6-[(7-isocyanato-9H-fluoren-2-yl)carbamoylamino]-1,3,5-triazin-2-yl]carbamoylamino]-9,10-dihydroanthracen-2-yl] cyanate |
| SMILES | N#COc1ccc2c(c1)Cc1cc(NC(=O)Nc3nc(Cl)nc(NC(=O)Nc4ccc5c(c4)Cc4cc(N=C=O)ccc4-5)n3)ccc1C2 |
| InChI | InChI=1S/C34H22ClN9O4/c35-30-40-31(43-33(46)38-25-3-1-18-9-19-2-6-27(48-16-36)15-21(19)10-20(18)12-25)42-32(41-30)44-34(47)39-26-5-8-29-23(14-26)11-22-13-24(37-17-45)4-7-28(22)29/h1-8,12-15H,9-11H2,(H4,38,39,40,41,42,43,44,46,47) |
| InChIKey | ISAAJRMXZODIPX-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 183.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.06 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|