About 2-methylbutyl 3-[4-[4-[(4-methylphenyl)methylideneamino]phenyl]phenyl]prop-2-enoate
2-methylbutyl 3-[4-[4-[(4-methylphenyl)methylideneamino]phenyl]phenyl]prop-2-enoate (PubChem CID 58121589) has the molecular formula C28H29NO2
and a molecular weight of 411.55 g/mol. Its IUPAC name is 2-methylbutyl 3-[4-[4-[(4-methylphenyl)methylideneamino]phenyl]phenyl]prop-2-enoate.
Molecular Properties
| Compound Name | 2-methylbutyl 3-[4-[4-[(4-methylphenyl)methylideneamino]phenyl]phenyl]prop-2-enoate |
| PubChem CID | 58121589 |
| Molecular Formula | C28H29NO2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 2-methylbutyl 3-[4-[4-[(4-methylphenyl)methylideneamino]phenyl]phenyl]prop-2-enoate |
| SMILES | CCC(C)COC(=O)C=Cc1ccc(-c2ccc(/N=C/c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H29NO2/c1-4-21(2)20-31-28(30)18-11-23-9-12-25(13-10-23)26-14-16-27(17-15-26)29-19-24-7-5-22(3)6-8-24/h5-19,21H,4,20H2,1-3H3/b18-11?,29-19+ |
| InChIKey | DLPRXQBRMTXYMM-UBODWFDMSA-N |
| XLogP | 7.02 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutyl 3-[4-[4-[(4-methylphenyl)methylideneamino]phenyl]phenyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutyl 3-[4-[4-[(4-methylphenyl)methylideneamino]phenyl]phenyl]prop-2-enoate?
The IUPAC name of 2-methylbutyl 3-[4-[4-[(4-methylphenyl)methylideneamino]phenyl]phenyl]prop-2-enoate (CID 58121589) is 2-methylbutyl 3-[4-[4-[(4-methylphenyl)methylideneamino]phenyl]phenyl]prop-2-enoate.
What is the SMILES notation for 2-methylbutyl 3-[4-[4-[(4-methylphenyl)methylideneamino]phenyl]phenyl]prop-2-enoate?
The canonical SMILES for 2-methylbutyl 3-[4-[4-[(4-methylphenyl)methylideneamino]phenyl]phenyl]prop-2-enoate is CCC(C)COC(=O)C=Cc1ccc(-c2ccc(/N=C/c3ccc(C)cc3)cc2)cc1.
What is the InChIKey of 2-methylbutyl 3-[4-[4-[(4-methylphenyl)methylideneamino]phenyl]phenyl]prop-2-enoate?
The InChIKey is DLPRXQBRMTXYMM-UBODWFDMSA-N. The full InChI is InChI=1S/C28H29NO2/c1-4-21(2)20-31-28(30)18-11-23-9-12-25(13-10-23)26-14-16-27(17-15-26)29-19-24-7-5-22(3)6-8-24/h5-19,21H,4,20H2,1-3H3/b18-11?,29-19+.
What are the key properties of 2-methylbutyl 3-[4-[4-[(4-methylphenyl)methylideneamino]phenyl]phenyl]prop-2-enoate?
2-methylbutyl 3-[4-[4-[(4-methylphenyl)methylideneamino]phenyl]phenyl]prop-2-enoate has a molecular weight of 411.55 g/mol, XLogP of 7.02, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutyl 3-[4-[4-[(4-methylphenyl)methylideneamino]phenyl]phenyl]prop-2-enoate is sourced from PubChem (CID 58121589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).