C55H44N2Si — CID 58121632
N-[4-(9,10-dinaphthalen-2-ylanthracen-2-yl)phenyl]-6-methyl-N-(4-trimethylsilylphenyl)pyridin-2-amine (PubChem CID 58121632) has the molecular formula C55H44N2Si and a molecular weight of 761.06 g/mol. Its IUPAC name is N-[4-(9,10-dinaphthalen-2-ylanthracen-2-yl)phenyl]-6-methyl-N-(4-trimethylsilylphenyl)pyridin-2-amine.
| Compound Name | N-[4-(9,10-dinaphthalen-2-ylanthracen-2-yl)phenyl]-6-methyl-N-(4-trimethylsilylphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 58121632 |
| Molecular Formula | C55H44N2Si |
| Molecular Weight | 761.06 g/mol |
| Exact Mass | 760.33 |
| IUPAC Name | N-[4-(9,10-dinaphthalen-2-ylanthracen-2-yl)phenyl]-6-methyl-N-(4-trimethylsilylphenyl)pyridin-2-amine |
| SMILES | Cc1cccc(N(c2ccc(-c3ccc4c(-c5ccc6ccccc6c5)c5ccccc5c(-c5ccc6ccccc6c5)c4c3)cc2)c2ccc([Si](C)(C)C)cc2)n1 |
| InChI | InChI=1S/C55H44N2Si/c1-37-12-11-19-53(56-37)57(47-29-31-48(32-30-47)58(2,3)4)46-27-24-40(25-28-46)43-26-33-51-52(36-43)55(45-23-21-39-14-6-8-16-42(39)35-45)50-18-10-9-17-49(50)54(51)44-22-20-38-13-5-7-15-41(38)34-44/h5-36H,1-4H3 |
| InChIKey | OMRFRJPFVLVFPU-UHFFFAOYSA-N |
| XLogP | 15.02 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.06 |
| LogP ≤ 5 | 15.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|