C32H20F6N2O4 — CID 58121685
6,13-bis[[3-methyl-5-(trifluoromethyl)phenyl]methyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 58121685) has the molecular formula C32H20F6N2O4 and a molecular weight of 610.51 g/mol. Its IUPAC name is 6,13-bis[[3-methyl-5-(trifluoromethyl)phenyl]methyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6,13-bis[[3-methyl-5-(trifluoromethyl)phenyl]methyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 58121685 |
| Molecular Formula | C32H20F6N2O4 |
| Molecular Weight | 610.51 g/mol |
| Exact Mass | 610.13 |
| IUPAC Name | 6,13-bis[[3-methyl-5-(trifluoromethyl)phenyl]methyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | Cc1cc(CN2C(=O)c3ccc4c5c(ccc(c35)C2=O)C(=O)N(Cc2cc(C)cc(C(F)(F)F)c2)C4=O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H20F6N2O4/c1-15-7-17(11-19(9-15)31(33,34)35)13-39-27(41)21-3-5-23-26-24(6-4-22(25(21)26)28(39)42)30(44)40(29(23)43)14-18-8-16(2)10-20(12-18)32(36,37)38/h3-12H,13-14H2,1-2H3 |
| InChIKey | NQADQUHVIUZOGU-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.51 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|