About 7-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-[1]benzothiolo[3,2-b][1]benzothiole
7-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-[1]benzothiolo[3,2-b][1]benzothiole (PubChem CID 58121720) has the molecular formula C28H17F3S2
and a molecular weight of 474.57 g/mol. Its IUPAC name is 7-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-[1]benzothiolo[3,2-b][1]benzothiole.
Molecular Properties
| Compound Name | 7-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-[1]benzothiolo[3,2-b][1]benzothiole |
| PubChem CID | 58121720 |
| Molecular Formula | C28H17F3S2 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | 7-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-[1]benzothiolo[3,2-b][1]benzothiole |
| SMILES | Cc1ccc(-c2ccc3c(c2)sc2c4ccc(-c5ccc(C(F)(F)F)cc5)cc4sc32)cc1 |
| InChI | InChI=1S/C28H17F3S2/c1-16-2-4-17(5-3-16)19-8-12-22-24(14-19)32-27-23-13-9-20(15-25(23)33-26(22)27)18-6-10-21(11-7-18)28(29,30)31/h2-15H,1H3 |
| InChIKey | YVPBNSXYKPMNTQ-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-[1]benzothiolo[3,2-b][1]benzothiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-[1]benzothiolo[3,2-b][1]benzothiole?
The IUPAC name of 7-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-[1]benzothiolo[3,2-b][1]benzothiole (CID 58121720) is 7-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-[1]benzothiolo[3,2-b][1]benzothiole.
What is the SMILES notation for 7-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-[1]benzothiolo[3,2-b][1]benzothiole?
The canonical SMILES for 7-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-[1]benzothiolo[3,2-b][1]benzothiole is Cc1ccc(-c2ccc3c(c2)sc2c4ccc(-c5ccc(C(F)(F)F)cc5)cc4sc32)cc1.
What is the InChIKey of 7-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-[1]benzothiolo[3,2-b][1]benzothiole?
The InChIKey is YVPBNSXYKPMNTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H17F3S2/c1-16-2-4-17(5-3-16)19-8-12-22-24(14-19)32-27-23-13-9-20(15-25(23)33-26(22)27)18-6-10-21(11-7-18)28(29,30)31/h2-15H,1H3.
What are the key properties of 7-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-[1]benzothiolo[3,2-b][1]benzothiole?
7-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-[1]benzothiolo[3,2-b][1]benzothiole has a molecular weight of 474.57 g/mol, XLogP of 9.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-[1]benzothiolo[3,2-b][1]benzothiole is sourced from PubChem (CID 58121720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).