C27H26F3N2O2Pt- — CID 58121730
2-(4-methylphenyl)-3-[4-(trifluoromethyl)benzene-6-id-1-yl]quinoxaline;pentane-2,4-diol;platinum (PubChem CID 58121730) has the molecular formula C27H26F3N2O2Pt- and a molecular weight of 662.59 g/mol. Its IUPAC name is 2-(4-methylphenyl)-3-[4-(trifluoromethyl)benzene-6-id-1-yl]quinoxaline;pentane-2,4-diol;platinum.
| Compound Name | 2-(4-methylphenyl)-3-[4-(trifluoromethyl)benzene-6-id-1-yl]quinoxaline;pentane-2,4-diol;platinum |
|---|---|
| PubChem CID | 58121730 |
| Molecular Formula | C27H26F3N2O2Pt- |
| Molecular Weight | 662.59 g/mol |
| Exact Mass | 662.16 |
| IUPAC Name | 2-(4-methylphenyl)-3-[4-(trifluoromethyl)benzene-6-id-1-yl]quinoxaline;pentane-2,4-diol;platinum |
| SMILES | CC(O)CC(C)O.Cc1ccc(-c2nc3ccccc3nc2-c2[c-]cc(C(F)(F)F)cc2)cc1.[Pt] |
| InChI | InChI=1S/C22H14F3N2.C5H12O2.Pt/c1-14-6-8-15(9-7-14)20-21(27-19-5-3-2-4-18(19)26-20)16-10-12-17(13-11-16)22(23,24)25;1-4(6)3-5(2)7;/h2-10,12-13H,1H3;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | ZMFRSEMZDKGHEP-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.59 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|