C28H41N — CID 58121799
N-(4-cyclohexa-1,3-dien-1-ylcyclohexyl)-N-[(2Z,4Z)-hexa-2,4-dienyl]-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-amine (PubChem CID 58121799) has the molecular formula C28H41N and a molecular weight of 391.64 g/mol. Its IUPAC name is N-(4-cyclohexa-1,3-dien-1-ylcyclohexyl)-N-[(2Z,4Z)-hexa-2,4-dienyl]-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-amine.
| Compound Name | N-(4-cyclohexa-1,3-dien-1-ylcyclohexyl)-N-[(2Z,4Z)-hexa-2,4-dienyl]-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 58121799 |
| Molecular Formula | C28H41N |
| Molecular Weight | 391.64 g/mol |
| Exact Mass | 391.32 |
| IUPAC Name | N-(4-cyclohexa-1,3-dien-1-ylcyclohexyl)-N-[(2Z,4Z)-hexa-2,4-dienyl]-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-amine |
| SMILES | C/C=C\C=C/CN(C1CCC(C2=CC=CCC2)CC1)C1CCCC2CCC=CC21 |
| InChI | InChI=1S/C28H41N/c1-2-3-4-10-22-29(28-17-11-15-25-14-8-9-16-27(25)28)26-20-18-24(19-21-26)23-12-6-5-7-13-23/h2-6,9-10,12,16,24-28H,7-8,11,13-15,17-22H2,1H3/b3-2-,10-4- |
| InChIKey | QMVAVGMAHJQJQD-AHYMPWADSA-N |
| XLogP | 7.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.64 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|