C28H30N2 — CID 58121814
4-N-(4,4a-dihydronaphthalen-1-yl)-1-N-cyclohexa-1,3-dien-1-yl-1-N-cyclohexa-1,5-dien-1-ylcyclohexa-1,5-diene-1,4-diamine (PubChem CID 58121814) has the molecular formula C28H30N2 and a molecular weight of 394.56 g/mol. Its IUPAC name is 4-N-(4,4a-dihydronaphthalen-1-yl)-1-N-cyclohexa-1,3-dien-1-yl-1-N-cyclohexa-1,5-dien-1-ylcyclohexa-1,5-diene-1,4-diamine.
| Compound Name | 4-N-(4,4a-dihydronaphthalen-1-yl)-1-N-cyclohexa-1,3-dien-1-yl-1-N-cyclohexa-1,5-dien-1-ylcyclohexa-1,5-diene-1,4-diamine |
|---|---|
| PubChem CID | 58121814 |
| Molecular Formula | C28H30N2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 4-N-(4,4a-dihydronaphthalen-1-yl)-1-N-cyclohexa-1,3-dien-1-yl-1-N-cyclohexa-1,5-dien-1-ylcyclohexa-1,5-diene-1,4-diamine |
| SMILES | C1=CCCC(N(C2=CCCC=C2)C2=CCC(NC3=C4C=CC=CC4CC=C3)C=C2)=C1 |
| InChI | InChI=1S/C28H30N2/c1-3-12-24(13-4-1)30(25-14-5-2-6-15-25)26-20-18-23(19-21-26)29-28-17-9-11-22-10-7-8-16-27(22)28/h1,3,5,7-10,12,14-18,20-23,29H,2,4,6,11,13,19H2 |
| InChIKey | GLSAAZHEXRDRDU-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |