C16H23N — CID 58121856
N-[(3E,5E)-7,7-dimethylocta-1,3,5-trien-3-yl]cyclohexa-1,5-dien-1-amine (PubChem CID 58121856) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is N-[(3E,5E)-7,7-dimethylocta-1,3,5-trien-3-yl]cyclohexa-1,5-dien-1-amine.
| Compound Name | N-[(3E,5E)-7,7-dimethylocta-1,3,5-trien-3-yl]cyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 58121856 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | N-[(3E,5E)-7,7-dimethylocta-1,3,5-trien-3-yl]cyclohexa-1,5-dien-1-amine |
| SMILES | C=C/C(=C\C=C\C(C)(C)C)NC1=CCCC=C1 |
| InChI | InChI=1S/C16H23N/c1-5-14(12-9-13-16(2,3)4)17-15-10-7-6-8-11-15/h5,7,9-13,17H,1,6,8H2,2-4H3/b13-9+,14-12+ |
| InChIKey | WRDDZBWNUIUQDJ-IHJNGOQESA-N |
| XLogP | 4.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|