C13H19N — CID 58121867
(1E)-N-[(3E)-hexa-1,3,5-trien-3-yl]-4-methylhexa-1,5-dien-1-amine (PubChem CID 58121867) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is (1E)-N-[(3E)-hexa-1,3,5-trien-3-yl]-4-methylhexa-1,5-dien-1-amine.
| Compound Name | (1E)-N-[(3E)-hexa-1,3,5-trien-3-yl]-4-methylhexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 58121867 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (1E)-N-[(3E)-hexa-1,3,5-trien-3-yl]-4-methylhexa-1,5-dien-1-amine |
| SMILES | C=C/C=C(\C=C)N/C=C/CC(C)C=C |
| InChI | InChI=1S/C13H19N/c1-5-9-13(7-3)14-11-8-10-12(4)6-2/h5-9,11-12,14H,1-3,10H2,4H3/b11-8+,13-9+ |
| InChIKey | PNKJXSXUBARVIE-BLTLMDCKSA-N |
| XLogP | 3.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|