About N-cyclohexa-2,4-dien-1-yl-4-methylcyclohexa-1,5-dien-1-amine
N-cyclohexa-2,4-dien-1-yl-4-methylcyclohexa-1,5-dien-1-amine (PubChem CID 58121899) has the molecular formula C13H17N
and a molecular weight of 187.29 g/mol. Its IUPAC name is N-cyclohexa-2,4-dien-1-yl-4-methylcyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | N-cyclohexa-2,4-dien-1-yl-4-methylcyclohexa-1,5-dien-1-amine |
| PubChem CID | 58121899 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | N-cyclohexa-2,4-dien-1-yl-4-methylcyclohexa-1,5-dien-1-amine |
| SMILES | CC1C=CC(NC2C=CC=CC2)=CC1 |
| InChI | InChI=1S/C13H17N/c1-11-7-9-13(10-8-11)14-12-5-3-2-4-6-12/h2-5,7,9-12,14H,6,8H2,1H3 |
| InChIKey | YGSUIEMGSLYZEH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclohexa-2,4-dien-1-yl-4-methylcyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexa-2,4-dien-1-yl-4-methylcyclohexa-1,5-dien-1-amine?
The IUPAC name of N-cyclohexa-2,4-dien-1-yl-4-methylcyclohexa-1,5-dien-1-amine (CID 58121899) is N-cyclohexa-2,4-dien-1-yl-4-methylcyclohexa-1,5-dien-1-amine.
What is the SMILES notation for N-cyclohexa-2,4-dien-1-yl-4-methylcyclohexa-1,5-dien-1-amine?
The canonical SMILES for N-cyclohexa-2,4-dien-1-yl-4-methylcyclohexa-1,5-dien-1-amine is CC1C=CC(NC2C=CC=CC2)=CC1.
What is the InChIKey of N-cyclohexa-2,4-dien-1-yl-4-methylcyclohexa-1,5-dien-1-amine?
The InChIKey is YGSUIEMGSLYZEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N/c1-11-7-9-13(10-8-11)14-12-5-3-2-4-6-12/h2-5,7,9-12,14H,6,8H2,1H3.
What are the key properties of N-cyclohexa-2,4-dien-1-yl-4-methylcyclohexa-1,5-dien-1-amine?
N-cyclohexa-2,4-dien-1-yl-4-methylcyclohexa-1,5-dien-1-amine has a molecular weight of 187.29 g/mol, XLogP of 2.94, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexa-2,4-dien-1-yl-4-methylcyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 58121899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).