C57H66O10 — CID 58122001
pentabenzyl 1,1,3,5,7,9-hexamethylundecane-1,3,5,7,9-pentacarboxylate (PubChem CID 58122001) has the molecular formula C57H66O10 and a molecular weight of 911.15 g/mol. Its IUPAC name is pentabenzyl 1,1,3,5,7,9-hexamethylundecane-1,3,5,7,9-pentacarboxylate.
| Compound Name | pentabenzyl 1,1,3,5,7,9-hexamethylundecane-1,3,5,7,9-pentacarboxylate |
|---|---|
| PubChem CID | 58122001 |
| Molecular Formula | C57H66O10 |
| Molecular Weight | 911.15 g/mol |
| Exact Mass | 910.47 |
| IUPAC Name | pentabenzyl 1,1,3,5,7,9-hexamethylundecane-1,3,5,7,9-pentacarboxylate |
| SMILES | CCC(C)(CC(C)(CC(C)(CC(C)(CC(C)(C)C(=O)OCc1ccccc1)C(=O)OCc1ccccc1)C(=O)OCc1ccccc1)C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C57H66O10/c1-8-54(4,49(59)64-35-44-26-16-10-17-27-44)40-56(6,51(61)66-37-46-30-20-12-21-31-46)42-57(7,52(62)67-38-47-32-22-13-23-33-47)41-55(5,50(60)65-36-45-28-18-11-19-29-45)39-53(2,3)48(58)63-34-43-24-14-9-15-25-43/h9-33H,8,34-42H2,1-7H3 |
| InChIKey | JASULJAHHWGSOF-UHFFFAOYSA-N |
| XLogP | 11.73 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.15 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|