About CID 58122074
CID 58122074 (PubChem CID 58122074) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol.
Molecular Properties
| Compound Name | CID 58122074 |
| PubChem CID | 58122074 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | — |
| SMILES | [CH]C(C)(C)CNC(=O)C(C)CC |
| InChI | InChI=1S/C10H19NO/c1-6-8(2)9(12)11-7-10(3,4)5/h3,8H,6-7H2,1-2,4-5H3,(H,11,12) |
| InChIKey | MELGQLSXZKRBFQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 58122074 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58122074?
The IUPAC name of CID 58122074 (CID 58122074) is not available.
What is the SMILES notation for CID 58122074?
The canonical SMILES for CID 58122074 is [CH]C(C)(C)CNC(=O)C(C)CC.
What is the InChIKey of CID 58122074?
The InChIKey is MELGQLSXZKRBFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO/c1-6-8(2)9(12)11-7-10(3,4)5/h3,8H,6-7H2,1-2,4-5H3,(H,11,12).
What are the key properties of CID 58122074?
CID 58122074 has a molecular weight of 169.27 g/mol, XLogP of 1.89, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58122074 is sourced from PubChem (CID 58122074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).