About 1-[2-fluoro-2,3-bis(2-oxobut-3-enoxy)propoxy]but-3-en-2-one
1-[2-fluoro-2,3-bis(2-oxobut-3-enoxy)propoxy]but-3-en-2-one (PubChem CID 58122167) has the molecular formula C15H19FO6
and a molecular weight of 314.31 g/mol. Its IUPAC name is 1-[2-fluoro-2,3-bis(2-oxobut-3-enoxy)propoxy]but-3-en-2-one.
Molecular Properties
| Compound Name | 1-[2-fluoro-2,3-bis(2-oxobut-3-enoxy)propoxy]but-3-en-2-one |
| PubChem CID | 58122167 |
| Molecular Formula | C15H19FO6 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 1-[2-fluoro-2,3-bis(2-oxobut-3-enoxy)propoxy]but-3-en-2-one |
| SMILES | C=CC(=O)COCC(F)(COCC(=O)C=C)OCC(=O)C=C |
| InChI | InChI=1S/C15H19FO6/c1-4-12(17)7-20-10-15(16,22-9-14(19)6-3)11-21-8-13(18)5-2/h4-6H,1-3,7-11H2 |
| InChIKey | QYUKDFUVXSAQRU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-fluoro-2,3-bis(2-oxobut-3-enoxy)propoxy]but-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-fluoro-2,3-bis(2-oxobut-3-enoxy)propoxy]but-3-en-2-one?
The IUPAC name of 1-[2-fluoro-2,3-bis(2-oxobut-3-enoxy)propoxy]but-3-en-2-one (CID 58122167) is 1-[2-fluoro-2,3-bis(2-oxobut-3-enoxy)propoxy]but-3-en-2-one.
What is the SMILES notation for 1-[2-fluoro-2,3-bis(2-oxobut-3-enoxy)propoxy]but-3-en-2-one?
The canonical SMILES for 1-[2-fluoro-2,3-bis(2-oxobut-3-enoxy)propoxy]but-3-en-2-one is C=CC(=O)COCC(F)(COCC(=O)C=C)OCC(=O)C=C.
What is the InChIKey of 1-[2-fluoro-2,3-bis(2-oxobut-3-enoxy)propoxy]but-3-en-2-one?
The InChIKey is QYUKDFUVXSAQRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19FO6/c1-4-12(17)7-20-10-15(16,22-9-14(19)6-3)11-21-8-13(18)5-2/h4-6H,1-3,7-11H2.
What are the key properties of 1-[2-fluoro-2,3-bis(2-oxobut-3-enoxy)propoxy]but-3-en-2-one?
1-[2-fluoro-2,3-bis(2-oxobut-3-enoxy)propoxy]but-3-en-2-one has a molecular weight of 314.31 g/mol, XLogP of 0.97, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-fluoro-2,3-bis(2-oxobut-3-enoxy)propoxy]but-3-en-2-one is sourced from PubChem (CID 58122167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).