C35H44NO5Si3+ — CID 58122282
diethyl-[2-hydroxy-3-[3-[(methoxy-methyl-octadeca-1,3,5,7,9,11,13,15,17-nonaynylsilyl)oxy-methyl-trimethylsilyloxysilyl]propoxy]propyl]-methylazanium (PubChem CID 58122282) has the molecular formula C35H44NO5Si3+ and a molecular weight of 643.00 g/mol. Its IUPAC name is diethyl-[2-hydroxy-3-[3-[(methoxy-methyl-octadeca-1,3,5,7,9,11,13,15,17-nonaynylsilyl)oxy-methyl-trimethylsilyloxysilyl]propoxy]propyl]-methylazanium.
| Compound Name | diethyl-[2-hydroxy-3-[3-[(methoxy-methyl-octadeca-1,3,5,7,9,11,13,15,17-nonaynylsilyl)oxy-methyl-trimethylsilyloxysilyl]propoxy]propyl]-methylazanium |
|---|---|
| PubChem CID | 58122282 |
| Molecular Formula | C35H44NO5Si3+ |
| Molecular Weight | 643.00 g/mol |
| Exact Mass | 642.25 |
| IUPAC Name | diethyl-[2-hydroxy-3-[3-[(methoxy-methyl-octadeca-1,3,5,7,9,11,13,15,17-nonaynylsilyl)oxy-methyl-trimethylsilyloxysilyl]propoxy]propyl]-methylazanium |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC#CC#C[Si](C)(OC)O[Si](C)(CCCOCC(O)C[N+](C)(CC)CC)O[Si](C)(C)C |
| InChI | InChI=1S/C35H44NO5Si3/c1-11-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-31-43(9,38-5)41-44(10,40-42(6,7)8)32-29-30-39-34-35(37)33-36(4,12-2)13-3/h1,35,37H,12-13,29-30,32-34H2,2-10H3/q+1 |
| InChIKey | XKCWZTKCPUCEPG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.00 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|