C11H19F2NO2S — CID 58122701
1-(1,1-difluoroethylsulfonyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 58122701) has the molecular formula C11H19F2NO2S and a molecular weight of 267.34 g/mol. Its IUPAC name is 1-(1,1-difluoroethylsulfonyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | 1-(1,1-difluoroethylsulfonyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 58122701 |
| Molecular Formula | C11H19F2NO2S |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 1-(1,1-difluoroethylsulfonyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | CC(F)(F)S(=O)(=O)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C11H19F2NO2S/c1-11(12,13)17(15,16)14-8-4-6-9-5-2-3-7-10(9)14/h9-10H,2-8H2,1H3 |
| InChIKey | KQHPSVCBEARQHD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |