About 1-(1,1-difluoroethylsulfonyl)-2,6-dimethylpiperidine
1-(1,1-difluoroethylsulfonyl)-2,6-dimethylpiperidine (PubChem CID 58122733) has the molecular formula C9H17F2NO2S
and a molecular weight of 241.30 g/mol. Its IUPAC name is 1-(1,1-difluoroethylsulfonyl)-2,6-dimethylpiperidine.
Molecular Properties
| Compound Name | 1-(1,1-difluoroethylsulfonyl)-2,6-dimethylpiperidine |
| PubChem CID | 58122733 |
| Molecular Formula | C9H17F2NO2S |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 1-(1,1-difluoroethylsulfonyl)-2,6-dimethylpiperidine |
| SMILES | CC1CCCC(C)N1S(=O)(=O)C(C)(F)F |
| InChI | InChI=1S/C9H17F2NO2S/c1-7-5-4-6-8(2)12(7)15(13,14)9(3,10)11/h7-8H,4-6H2,1-3H3 |
| InChIKey | GCAWIIRXKBQULV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1,1-difluoroethylsulfonyl)-2,6-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-difluoroethylsulfonyl)-2,6-dimethylpiperidine?
The IUPAC name of 1-(1,1-difluoroethylsulfonyl)-2,6-dimethylpiperidine (CID 58122733) is 1-(1,1-difluoroethylsulfonyl)-2,6-dimethylpiperidine.
What is the SMILES notation for 1-(1,1-difluoroethylsulfonyl)-2,6-dimethylpiperidine?
The canonical SMILES for 1-(1,1-difluoroethylsulfonyl)-2,6-dimethylpiperidine is CC1CCCC(C)N1S(=O)(=O)C(C)(F)F.
What is the InChIKey of 1-(1,1-difluoroethylsulfonyl)-2,6-dimethylpiperidine?
The InChIKey is GCAWIIRXKBQULV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F2NO2S/c1-7-5-4-6-8(2)12(7)15(13,14)9(3,10)11/h7-8H,4-6H2,1-3H3.
What are the key properties of 1-(1,1-difluoroethylsulfonyl)-2,6-dimethylpiperidine?
1-(1,1-difluoroethylsulfonyl)-2,6-dimethylpiperidine has a molecular weight of 241.30 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-difluoroethylsulfonyl)-2,6-dimethylpiperidine is sourced from PubChem (CID 58122733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).