About 3-(1-adamantyl)-1,1-difluoro-2-oxopropane-1-sulfonate
3-(1-adamantyl)-1,1-difluoro-2-oxopropane-1-sulfonate (PubChem CID 58122739) has the molecular formula C13H17F2O4S-
and a molecular weight of 307.34 g/mol. Its IUPAC name is 3-(1-adamantyl)-1,1-difluoro-2-oxopropane-1-sulfonate.
Molecular Properties
| Compound Name | 3-(1-adamantyl)-1,1-difluoro-2-oxopropane-1-sulfonate |
| PubChem CID | 58122739 |
| Molecular Formula | C13H17F2O4S- |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 3-(1-adamantyl)-1,1-difluoro-2-oxopropane-1-sulfonate |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C13H18F2O4S/c14-13(15,20(17,18)19)11(16)7-12-4-8-1-9(5-12)3-10(2-8)6-12/h8-10H,1-7H2,(H,17,18,19)/p-1 |
| InChIKey | JCIRIGDWCGELDZ-UHFFFAOYSA-M |
| XLogP | 2.30 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-adamantyl)-1,1-difluoro-2-oxopropane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-adamantyl)-1,1-difluoro-2-oxopropane-1-sulfonate?
The IUPAC name of 3-(1-adamantyl)-1,1-difluoro-2-oxopropane-1-sulfonate (CID 58122739) is 3-(1-adamantyl)-1,1-difluoro-2-oxopropane-1-sulfonate.
What is the SMILES notation for 3-(1-adamantyl)-1,1-difluoro-2-oxopropane-1-sulfonate?
The canonical SMILES for 3-(1-adamantyl)-1,1-difluoro-2-oxopropane-1-sulfonate is O=C(CC12CC3CC(CC(C3)C1)C2)C(F)(F)S(=O)(=O)[O-].
What is the InChIKey of 3-(1-adamantyl)-1,1-difluoro-2-oxopropane-1-sulfonate?
The InChIKey is JCIRIGDWCGELDZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H18F2O4S/c14-13(15,20(17,18)19)11(16)7-12-4-8-1-9(5-12)3-10(2-8)6-12/h8-10H,1-7H2,(H,17,18,19)/p-1.
What are the key properties of 3-(1-adamantyl)-1,1-difluoro-2-oxopropane-1-sulfonate?
3-(1-adamantyl)-1,1-difluoro-2-oxopropane-1-sulfonate has a molecular weight of 307.34 g/mol, XLogP of 2.30, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-adamantyl)-1,1-difluoro-2-oxopropane-1-sulfonate is sourced from PubChem (CID 58122739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).