C12H19F2NO — CID 58122783
1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2,2-difluoropropan-1-one (PubChem CID 58122783) has the molecular formula C12H19F2NO and a molecular weight of 231.29 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2,2-difluoropropan-1-one.
| Compound Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2,2-difluoropropan-1-one |
|---|---|
| PubChem CID | 58122783 |
| Molecular Formula | C12H19F2NO |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2,2-difluoropropan-1-one |
| SMILES | CC(F)(F)C(=O)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C12H19F2NO/c1-12(13,14)11(16)15-8-4-6-9-5-2-3-7-10(9)15/h9-10H,2-8H2,1H3 |
| InChIKey | FKGLSHBHOSGYOI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |