C13H12F3N3O5 — CID 58122991
N-[3-[1-(1,3-dioxolan-2-ylmethyl)-2,4-dioxopyrimidin-5-yl]prop-2-ynyl]-2,2,2-trifluoroacetamide (PubChem CID 58122991) has the molecular formula C13H12F3N3O5 and a molecular weight of 347.25 g/mol. Its IUPAC name is N-[3-[1-(1,3-dioxolan-2-ylmethyl)-2,4-dioxopyrimidin-5-yl]prop-2-ynyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[1-(1,3-dioxolan-2-ylmethyl)-2,4-dioxopyrimidin-5-yl]prop-2-ynyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 58122991 |
| Molecular Formula | C13H12F3N3O5 |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N-[3-[1-(1,3-dioxolan-2-ylmethyl)-2,4-dioxopyrimidin-5-yl]prop-2-ynyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(NCC#Cc1cn(CC2OCCO2)c(=O)[nH]c1=O)C(F)(F)F |
| InChI | InChI=1S/C13H12F3N3O5/c14-13(15,16)11(21)17-3-1-2-8-6-19(12(22)18-10(8)20)7-9-23-4-5-24-9/h6,9H,3-5,7H2,(H,17,21)(H,18,20,22) |
| InChIKey | WBLUHUJFGCPNGM-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|