C15H18F3N3O5 — CID 58123042
N-[3-[1-(2,2-diethoxyethyl)-2,4-dioxopyrimidin-5-yl]prop-2-ynyl]-2,2,2-trifluoroacetamide (PubChem CID 58123042) has the molecular formula C15H18F3N3O5 and a molecular weight of 377.32 g/mol. Its IUPAC name is N-[3-[1-(2,2-diethoxyethyl)-2,4-dioxopyrimidin-5-yl]prop-2-ynyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[1-(2,2-diethoxyethyl)-2,4-dioxopyrimidin-5-yl]prop-2-ynyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 58123042 |
| Molecular Formula | C15H18F3N3O5 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | N-[3-[1-(2,2-diethoxyethyl)-2,4-dioxopyrimidin-5-yl]prop-2-ynyl]-2,2,2-trifluoroacetamide |
| SMILES | CCOC(Cn1cc(C#CCNC(=O)C(F)(F)F)c(=O)[nH]c1=O)OCC |
| InChI | InChI=1S/C15H18F3N3O5/c1-3-25-11(26-4-2)9-21-8-10(12(22)20-14(21)24)6-5-7-19-13(23)15(16,17)18/h8,11H,3-4,7,9H2,1-2H3,(H,19,23)(H,20,22,24) |
| InChIKey | MSAMSHIRTFQEGJ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|