About tert-butyl N-[(2S,3R)-3-[tert-butyl(diphenyl)silyl]oxypent-4-en-2-yl]carbamate
tert-butyl N-[(2S,3R)-3-[tert-butyl(diphenyl)silyl]oxypent-4-en-2-yl]carbamate (PubChem CID 58123160) has the molecular formula C26H37NO3Si
and a molecular weight of 439.67 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-3-[tert-butyl(diphenyl)silyl]oxypent-4-en-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(2S,3R)-3-[tert-butyl(diphenyl)silyl]oxypent-4-en-2-yl]carbamate |
| PubChem CID | 58123160 |
| Molecular Formula | C26H37NO3Si |
| Molecular Weight | 439.67 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | tert-butyl N-[(2S,3R)-3-[tert-butyl(diphenyl)silyl]oxypent-4-en-2-yl]carbamate |
| SMILES | C=C[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H37NO3Si/c1-9-23(20(2)27-24(28)29-25(3,4)5)30-31(26(6,7)8,21-16-12-10-13-17-21)22-18-14-11-15-19-22/h9-20,23H,1H2,2-8H3,(H,27,28)/t20-,23+/m0/s1 |
| InChIKey | VYEPQKBAJYHJBB-NZQKXSOJSA-N |
| XLogP | 5.03 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.67 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(2S,3R)-3-[tert-butyl(diphenyl)silyl]oxypent-4-en-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(2S,3R)-3-[tert-butyl(diphenyl)silyl]oxypent-4-en-2-yl]carbamate?
The IUPAC name of tert-butyl N-[(2S,3R)-3-[tert-butyl(diphenyl)silyl]oxypent-4-en-2-yl]carbamate (CID 58123160) is tert-butyl N-[(2S,3R)-3-[tert-butyl(diphenyl)silyl]oxypent-4-en-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(2S,3R)-3-[tert-butyl(diphenyl)silyl]oxypent-4-en-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[(2S,3R)-3-[tert-butyl(diphenyl)silyl]oxypent-4-en-2-yl]carbamate is C=C[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](C)NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(2S,3R)-3-[tert-butyl(diphenyl)silyl]oxypent-4-en-2-yl]carbamate?
The InChIKey is VYEPQKBAJYHJBB-NZQKXSOJSA-N. The full InChI is InChI=1S/C26H37NO3Si/c1-9-23(20(2)27-24(28)29-25(3,4)5)30-31(26(6,7)8,21-16-12-10-13-17-21)22-18-14-11-15-19-22/h9-20,23H,1H2,2-8H3,(H,27,28)/t20-,23+/m0/s1.
What are the key properties of tert-butyl N-[(2S,3R)-3-[tert-butyl(diphenyl)silyl]oxypent-4-en-2-yl]carbamate?
tert-butyl N-[(2S,3R)-3-[tert-butyl(diphenyl)silyl]oxypent-4-en-2-yl]carbamate has a molecular weight of 439.67 g/mol, XLogP of 5.03, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(2S,3R)-3-[tert-butyl(diphenyl)silyl]oxypent-4-en-2-yl]carbamate is sourced from PubChem (CID 58123160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).