C49H41NO4 — CID 58123246
N-[(2S,3R)-3-hydroxy-1-[(2R,3R,5R)-3,4,5-tris(ethenyl)-6-prop-2-enyloxan-2-yl]oxynonan-2-yl]hexacosa-2,4,6,8,10,12,14,16,18,20,22,24-dodecaynamide (PubChem CID 58123246) has the molecular formula C49H41NO4 and a molecular weight of 707.87 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-1-[(2R,3R,5R)-3,4,5-tris(ethenyl)-6-prop-2-enyloxan-2-yl]oxynonan-2-yl]hexacosa-2,4,6,8,10,12,14,16,18,20,22,24-dodecaynamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-1-[(2R,3R,5R)-3,4,5-tris(ethenyl)-6-prop-2-enyloxan-2-yl]oxynonan-2-yl]hexacosa-2,4,6,8,10,12,14,16,18,20,22,24-dodecaynamide |
|---|---|
| PubChem CID | 58123246 |
| Molecular Formula | C49H41NO4 |
| Molecular Weight | 707.87 g/mol |
| Exact Mass | 707.30 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-1-[(2R,3R,5R)-3,4,5-tris(ethenyl)-6-prop-2-enyloxan-2-yl]oxynonan-2-yl]hexacosa-2,4,6,8,10,12,14,16,18,20,22,24-dodecaynamide |
| SMILES | C=CCC1O[C@@H](OC[C@H](NC(=O)C#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC)[C@H](O)CCCCCC)[C@H](C=C)C(C=C)[C@H]1C=C |
| InChI | InChI=1S/C49H41NO4/c1-7-13-15-17-18-19-20-21-22-23-24-25-26-27-28-29-30-31-32-33-34-35-37-40-48(52)50-45(46(51)39-36-16-14-8-2)41-53-49-44(12-6)42(10-4)43(11-5)47(54-49)38-9-3/h9-12,42-47,49,51H,3-6,8,14,16,36,38-39,41H2,1-2H3,(H,50,52)/t42?,43-,44-,45+,46-,47?,49-/m1/s1 |
| InChIKey | WMDOKZVVACHYGY-HSORVAMUSA-N |
| XLogP | 4.59 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.87 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|