C17H23NO2 — CID 58123566
ethyl (1R,9R,13S)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxylate (PubChem CID 58123566) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is ethyl (1R,9R,13S)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxylate.
| Compound Name | ethyl (1R,9R,13S)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxylate |
|---|---|
| PubChem CID | 58123566 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | ethyl (1R,9R,13S)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)[C@]1(C)CCN[C@H](C2)[C@H]1C |
| InChI | InChI=1S/C17H23NO2/c1-4-20-16(19)13-6-5-12-10-15-11(2)17(3,7-8-18-15)14(12)9-13/h5-6,9,11,15,18H,4,7-8,10H2,1-3H3/t11-,15-,17-/m1/s1 |
| InChIKey | HDPKSCODYOVFKN-RGYTYGDFSA-N |
| XLogP | 2.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |