C23H30N4O2 — CID 58123568
[(1R,9R,13S)-1,13-dimethyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-piperidin-1-ylmethanone (PubChem CID 58123568) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is [(1R,9R,13S)-1,13-dimethyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-piperidin-1-ylmethanone.
| Compound Name | [(1R,9R,13S)-1,13-dimethyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 58123568 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | [(1R,9R,13S)-1,13-dimethyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-piperidin-1-ylmethanone |
| SMILES | Cc1nnc(-c2ccc3c(c2)[C@]2(C)CCN(C(=O)N4CCCCC4)[C@H](C3)[C@H]2C)o1 |
| InChI | InChI=1S/C23H30N4O2/c1-15-20-14-17-7-8-18(21-25-24-16(2)29-21)13-19(17)23(15,3)9-12-27(20)22(28)26-10-5-4-6-11-26/h7-8,13,15,20H,4-6,9-12,14H2,1-3H3/t15-,20-,23-/m1/s1 |
| InChIKey | GGNQSKXXJQDLGE-ZFUCPZCZSA-N |
| XLogP | 4.18 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |