C20H27NO4 — CID 58123640
(1R,9R,13S)-1,13-dimethyl-10-[(2-methylpropan-2-yl)oxycarbonyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxylic acid (PubChem CID 58123640) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is (1R,9R,13S)-1,13-dimethyl-10-[(2-methylpropan-2-yl)oxycarbonyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxylic acid.
| Compound Name | (1R,9R,13S)-1,13-dimethyl-10-[(2-methylpropan-2-yl)oxycarbonyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxylic acid |
|---|---|
| PubChem CID | 58123640 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | (1R,9R,13S)-1,13-dimethyl-10-[(2-methylpropan-2-yl)oxycarbonyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxylic acid |
| SMILES | C[C@@H]1[C@H]2Cc3ccc(C(=O)O)cc3[C@]1(C)CCN2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H27NO4/c1-12-16-11-13-6-7-14(17(22)23)10-15(13)20(12,5)8-9-21(16)18(24)25-19(2,3)4/h6-7,10,12,16H,8-9,11H2,1-5H3,(H,22,23)/t12-,16-,20-/m1/s1 |
| InChIKey | ZVDVZECCCAXXMD-CBLJQSSYSA-N |
| XLogP | 3.84 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |