C9H16N+ — CID 58123805
1-methyl-2-prop-2-enyl-3,4,5,6-tetrahydro-2H-pyridin-4-ylium (PubChem CID 58123805) has the molecular formula C9H16N+ and a molecular weight of 138.23 g/mol. Its IUPAC name is 1-methyl-2-prop-2-enyl-3,4,5,6-tetrahydro-2H-pyridin-4-ylium.
| Compound Name | 1-methyl-2-prop-2-enyl-3,4,5,6-tetrahydro-2H-pyridin-4-ylium |
|---|---|
| PubChem CID | 58123805 |
| Molecular Formula | C9H16N+ |
| Molecular Weight | 138.23 g/mol |
| Exact Mass | 138.13 |
| IUPAC Name | 1-methyl-2-prop-2-enyl-3,4,5,6-tetrahydro-2H-pyridin-4-ylium |
| SMILES | C=CCC1C[CH+]CCN1C |
| InChI | InChI=1S/C9H16N/c1-3-6-9-7-4-5-8-10(9)2/h3-4,9H,1,5-8H2,2H3/q+1 |
| InChIKey | SQXGUDGDDYUFEM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.23 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|