C18H19F3N2O2 — CID 58123829
2,2,2-trifluoro-1-[(1R,12R,16S)-1,6,16-trimethyl-5-oxa-7,13-diazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),6,9-tetraen-13-yl]ethanone (PubChem CID 58123829) has the molecular formula C18H19F3N2O2 and a molecular weight of 352.36 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[(1R,12R,16S)-1,6,16-trimethyl-5-oxa-7,13-diazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),6,9-tetraen-13-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[(1R,12R,16S)-1,6,16-trimethyl-5-oxa-7,13-diazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),6,9-tetraen-13-yl]ethanone |
|---|---|
| PubChem CID | 58123829 |
| Molecular Formula | C18H19F3N2O2 |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2,2,2-trifluoro-1-[(1R,12R,16S)-1,6,16-trimethyl-5-oxa-7,13-diazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),6,9-tetraen-13-yl]ethanone |
| SMILES | Cc1nc2cc3c(cc2o1)[C@]1(C)CCN(C(=O)C(F)(F)F)[C@H](C3)[C@H]1C |
| InChI | InChI=1S/C18H19F3N2O2/c1-9-14-7-11-6-13-15(25-10(2)22-13)8-12(11)17(9,3)4-5-23(14)16(24)18(19,20)21/h6,8-9,14H,4-5,7H2,1-3H3/t9-,14-,17-/m1/s1 |
| InChIKey | VRDAHARSNQIMKV-ZXJZVJERSA-N |
| XLogP | 3.75 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |