About N-(2,3-dihydroxypropyl)-3,3-dimethyl-2-propan-2-ylbutanamide
N-(2,3-dihydroxypropyl)-3,3-dimethyl-2-propan-2-ylbutanamide (PubChem CID 58124320) has the molecular formula C12H25NO3
and a molecular weight of 231.34 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-3,3-dimethyl-2-propan-2-ylbutanamide.
Molecular Properties
| Compound Name | N-(2,3-dihydroxypropyl)-3,3-dimethyl-2-propan-2-ylbutanamide |
| PubChem CID | 58124320 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-3,3-dimethyl-2-propan-2-ylbutanamide |
| SMILES | CC(C)C(C(=O)NCC(O)CO)C(C)(C)C |
| InChI | InChI=1S/C12H25NO3/c1-8(2)10(12(3,4)5)11(16)13-6-9(15)7-14/h8-10,14-15H,6-7H2,1-5H3,(H,13,16) |
| InChIKey | UFQHRIQOPHGNFX-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,3-dihydroxypropyl)-3,3-dimethyl-2-propan-2-ylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dihydroxypropyl)-3,3-dimethyl-2-propan-2-ylbutanamide?
The IUPAC name of N-(2,3-dihydroxypropyl)-3,3-dimethyl-2-propan-2-ylbutanamide (CID 58124320) is N-(2,3-dihydroxypropyl)-3,3-dimethyl-2-propan-2-ylbutanamide.
What is the SMILES notation for N-(2,3-dihydroxypropyl)-3,3-dimethyl-2-propan-2-ylbutanamide?
The canonical SMILES for N-(2,3-dihydroxypropyl)-3,3-dimethyl-2-propan-2-ylbutanamide is CC(C)C(C(=O)NCC(O)CO)C(C)(C)C.
What is the InChIKey of N-(2,3-dihydroxypropyl)-3,3-dimethyl-2-propan-2-ylbutanamide?
The InChIKey is UFQHRIQOPHGNFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO3/c1-8(2)10(12(3,4)5)11(16)13-6-9(15)7-14/h8-10,14-15H,6-7H2,1-5H3,(H,13,16).
What are the key properties of N-(2,3-dihydroxypropyl)-3,3-dimethyl-2-propan-2-ylbutanamide?
N-(2,3-dihydroxypropyl)-3,3-dimethyl-2-propan-2-ylbutanamide has a molecular weight of 231.34 g/mol, XLogP of 0.77, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dihydroxypropyl)-3,3-dimethyl-2-propan-2-ylbutanamide is sourced from PubChem (CID 58124320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).