About N-(3,3-dimethyl-2-propan-2-ylbutyl)propane-2-sulfonamide
N-(3,3-dimethyl-2-propan-2-ylbutyl)propane-2-sulfonamide (PubChem CID 58124408) has the molecular formula C12H27NO2S
and a molecular weight of 249.42 g/mol. Its IUPAC name is N-(3,3-dimethyl-2-propan-2-ylbutyl)propane-2-sulfonamide.
Molecular Properties
| Compound Name | N-(3,3-dimethyl-2-propan-2-ylbutyl)propane-2-sulfonamide |
| PubChem CID | 58124408 |
| Molecular Formula | C12H27NO2S |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | N-(3,3-dimethyl-2-propan-2-ylbutyl)propane-2-sulfonamide |
| SMILES | CC(C)C(CNS(=O)(=O)C(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H27NO2S/c1-9(2)11(12(5,6)7)8-13-16(14,15)10(3)4/h9-11,13H,8H2,1-7H3 |
| InChIKey | CATSAIHVYYYMNX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3,3-dimethyl-2-propan-2-ylbutyl)propane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-dimethyl-2-propan-2-ylbutyl)propane-2-sulfonamide?
The IUPAC name of N-(3,3-dimethyl-2-propan-2-ylbutyl)propane-2-sulfonamide (CID 58124408) is N-(3,3-dimethyl-2-propan-2-ylbutyl)propane-2-sulfonamide.
What is the SMILES notation for N-(3,3-dimethyl-2-propan-2-ylbutyl)propane-2-sulfonamide?
The canonical SMILES for N-(3,3-dimethyl-2-propan-2-ylbutyl)propane-2-sulfonamide is CC(C)C(CNS(=O)(=O)C(C)C)C(C)(C)C.
What is the InChIKey of N-(3,3-dimethyl-2-propan-2-ylbutyl)propane-2-sulfonamide?
The InChIKey is CATSAIHVYYYMNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27NO2S/c1-9(2)11(12(5,6)7)8-13-16(14,15)10(3)4/h9-11,13H,8H2,1-7H3.
What are the key properties of N-(3,3-dimethyl-2-propan-2-ylbutyl)propane-2-sulfonamide?
N-(3,3-dimethyl-2-propan-2-ylbutyl)propane-2-sulfonamide has a molecular weight of 249.42 g/mol, XLogP of 2.63, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-dimethyl-2-propan-2-ylbutyl)propane-2-sulfonamide is sourced from PubChem (CID 58124408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).