About 3-[(dimethylsulfamoylamino)methyl]-2,2,4-trimethylpentane
3-[(dimethylsulfamoylamino)methyl]-2,2,4-trimethylpentane (PubChem CID 58124476) has the molecular formula C11H26N2O2S
and a molecular weight of 250.41 g/mol. Its IUPAC name is 3-[(dimethylsulfamoylamino)methyl]-2,2,4-trimethylpentane.
Molecular Properties
| Compound Name | 3-[(dimethylsulfamoylamino)methyl]-2,2,4-trimethylpentane |
| PubChem CID | 58124476 |
| Molecular Formula | C11H26N2O2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 3-[(dimethylsulfamoylamino)methyl]-2,2,4-trimethylpentane |
| SMILES | CC(C)C(CNS(=O)(=O)N(C)C)C(C)(C)C |
| InChI | InChI=1S/C11H26N2O2S/c1-9(2)10(11(3,4)5)8-12-16(14,15)13(6)7/h9-10,12H,8H2,1-7H3 |
| InChIKey | LKPCBCCKCCXEQI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(dimethylsulfamoylamino)methyl]-2,2,4-trimethylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(dimethylsulfamoylamino)methyl]-2,2,4-trimethylpentane?
The IUPAC name of 3-[(dimethylsulfamoylamino)methyl]-2,2,4-trimethylpentane (CID 58124476) is 3-[(dimethylsulfamoylamino)methyl]-2,2,4-trimethylpentane.
What is the SMILES notation for 3-[(dimethylsulfamoylamino)methyl]-2,2,4-trimethylpentane?
The canonical SMILES for 3-[(dimethylsulfamoylamino)methyl]-2,2,4-trimethylpentane is CC(C)C(CNS(=O)(=O)N(C)C)C(C)(C)C.
What is the InChIKey of 3-[(dimethylsulfamoylamino)methyl]-2,2,4-trimethylpentane?
The InChIKey is LKPCBCCKCCXEQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26N2O2S/c1-9(2)10(11(3,4)5)8-12-16(14,15)13(6)7/h9-10,12H,8H2,1-7H3.
What are the key properties of 3-[(dimethylsulfamoylamino)methyl]-2,2,4-trimethylpentane?
3-[(dimethylsulfamoylamino)methyl]-2,2,4-trimethylpentane has a molecular weight of 250.41 g/mol, XLogP of 1.70, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(dimethylsulfamoylamino)methyl]-2,2,4-trimethylpentane is sourced from PubChem (CID 58124476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).