C21H28N2OY-2 — CID 58125203
ethane;[3-[[4-(methanidylamino)phenyl]methyl]cyclopentyl]-pyridin-3-ylmethanol;yttrium (PubChem CID 58125203) has the molecular formula C21H28N2OY-2 and a molecular weight of 413.37 g/mol. Its IUPAC name is ethane;[3-[[4-(methanidylamino)phenyl]methyl]cyclopentyl]-pyridin-3-ylmethanol;yttrium.
| Compound Name | ethane;[3-[[4-(methanidylamino)phenyl]methyl]cyclopentyl]-pyridin-3-ylmethanol;yttrium |
|---|---|
| PubChem CID | 58125203 |
| Molecular Formula | C21H28N2OY-2 |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | ethane;[3-[[4-(methanidylamino)phenyl]methyl]cyclopentyl]-pyridin-3-ylmethanol;yttrium |
| SMILES | [CH2-]C.[CH2-]Nc1ccc(CC2CCC(C(O)c3cccnc3)C2)cc1.[Y] |
| InChI | InChI=1S/C19H23N2O.C2H5.Y/c1-20-18-8-5-14(6-9-18)11-15-4-7-16(12-15)19(22)17-3-2-10-21-13-17;1-2;/h2-3,5-6,8-10,13,15-16,19-20,22H,1,4,7,11-12H2;1H2,2H3;/q2*-1; |
| InChIKey | CDZFRNDHJFXPQU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|