About 5-[(2,6-difluorophenyl)methylsulfanyl]-1-methyltetrazole
5-[(2,6-difluorophenyl)methylsulfanyl]-1-methyltetrazole (PubChem CID 581253) has the molecular formula C9H8F2N4S
and a molecular weight of 242.25 g/mol. Its IUPAC name is 5-[(2,6-difluorophenyl)methylsulfanyl]-1-methyltetrazole.
Molecular Properties
| Compound Name | 5-[(2,6-difluorophenyl)methylsulfanyl]-1-methyltetrazole |
| PubChem CID | 581253 |
| Molecular Formula | C9H8F2N4S |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 5-[(2,6-difluorophenyl)methylsulfanyl]-1-methyltetrazole |
| SMILES | Cn1nnnc1SCc1c(F)cccc1F |
| InChI | InChI=1S/C9H8F2N4S/c1-15-9(12-13-14-15)16-5-6-7(10)3-2-4-8(6)11/h2-4H,5H2,1H3 |
| InChIKey | NJUQHCNCNLCKPX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(2,6-difluorophenyl)methylsulfanyl]-1-methyltetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,6-difluorophenyl)methylsulfanyl]-1-methyltetrazole?
The IUPAC name of 5-[(2,6-difluorophenyl)methylsulfanyl]-1-methyltetrazole (CID 581253) is 5-[(2,6-difluorophenyl)methylsulfanyl]-1-methyltetrazole.
What is the SMILES notation for 5-[(2,6-difluorophenyl)methylsulfanyl]-1-methyltetrazole?
The canonical SMILES for 5-[(2,6-difluorophenyl)methylsulfanyl]-1-methyltetrazole is Cn1nnnc1SCc1c(F)cccc1F.
What is the InChIKey of 5-[(2,6-difluorophenyl)methylsulfanyl]-1-methyltetrazole?
The InChIKey is NJUQHCNCNLCKPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F2N4S/c1-15-9(12-13-14-15)16-5-6-7(10)3-2-4-8(6)11/h2-4H,5H2,1H3.
What are the key properties of 5-[(2,6-difluorophenyl)methylsulfanyl]-1-methyltetrazole?
5-[(2,6-difluorophenyl)methylsulfanyl]-1-methyltetrazole has a molecular weight of 242.25 g/mol, XLogP of 1.78, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,6-difluorophenyl)methylsulfanyl]-1-methyltetrazole is sourced from PubChem (CID 581253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).